3-(3,4,5-Trimethoxyphenyl)propanoic acid structure
|
Common Name | 3-(3,4,5-Trimethoxyphenyl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 25173-72-2 | Molecular Weight | 240.25200 | |
| Density | 1.169 g/cm3 | Boiling Point | 373.3ºC at 760 mmHg | |
| Molecular Formula | C12H16O5 | Melting Point | 100-104 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 139.9ºC | |
Use of 3-(3,4,5-Trimethoxyphenyl)propanoic acid3-(3,4,5-Trimethoxyphenyl)propanoic acid is found in herbs and spices. 3-(3,4,5-Trimethoxyphenyl)propanoic acid is a constituent of Piper longum (long pepper) and Piper retrofractum (Javanese long pepper). |
| Name | 3,4,5-trimethoxydihydrocinnamic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-(3,4,5-Trimethoxyphenyl)propanoic acid is found in herbs and spices. 3-(3,4,5-Trimethoxyphenyl)propanoic acid is a constituent of Piper longum (long pepper) and Piper retrofractum (Javanese long pepper). |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| Density | 1.169 g/cm3 |
|---|---|
| Boiling Point | 373.3ºC at 760 mmHg |
| Melting Point | 100-104 °C(lit.) |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25200 |
| Flash Point | 139.9ºC |
| Exact Mass | 240.10000 |
| PSA | 64.99000 |
| LogP | 1.72960 |
| Vapour Pressure | 3.1E-06mmHg at 25°C |
| InChIKey | ZCYXGVJUZBKJAI-UHFFFAOYSA-N |
| SMILES | COc1cc(CCC(=O)O)cc(OC)c1OC |
| Water Solubility | methanol: 0.1 g/mL, clear |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3,4,5-Trimethoxyphenyl)propionic acid |
| MFCD00002775 |
| 3,4,5-Trimethoxyhydrocinnamic acid |
| EINECS 246-706-4 |
| 3-(3,4,5-Trimethoxyphenyl)propanoic acid |
| 3,4,5-trimethoxy-benzenepropanoic acid |