Isochenodeoxycholic acid structure
|
Common Name | Isochenodeoxycholic acid | ||
|---|---|---|---|---|
| CAS Number | 566-24-5 | Molecular Weight | 392.57200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H40O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Isochenodeoxycholic acidIsochenodeoxycholic acid (isoCDCA) is a human fecal bile acid. Isochenodeoxycholic acid has cytoprotective against ethanol-induced cell injuries in HepG2 cells. Isochenodeoxycholic acid is a major metabolite of orally administered ursodeoxycholic acid (UDCA)[1]. |
| Name | 3α,7α-dihydroxy-(5β)-cholan-24-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Isochenodeoxycholic acid (isoCDCA) is a human fecal bile acid. Isochenodeoxycholic acid has cytoprotective against ethanol-induced cell injuries in HepG2 cells. Isochenodeoxycholic acid is a major metabolite of orally administered ursodeoxycholic acid (UDCA)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H40O4 |
|---|---|
| Molecular Weight | 392.57200 |
| Exact Mass | 392.29300 |
| PSA | 77.76000 |
| LogP | 4.47790 |
| InChIKey | RUDATBOHQWOJDD-JGFDLHJZSA-N |
| SMILES | CC(CCC(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
| Chenodeoxycholic Saeure |
| Cholsaeure |
| chenodeoxycholic acid |
| Galbsaeure |