Formestane structure
|
Common Name | Formestane | ||
|---|---|---|---|---|
| CAS Number | 566-48-3 | Molecular Weight | 302.408 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 475.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H26O3 | Melting Point | 199-202°C | |
| MSDS | Chinese USA | Flash Point | 255.4±25.2 °C | |
| Symbol |
GHS08 |
Signal Word | Danger | |
| Name | formestane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 475.4±45.0 °C at 760 mmHg |
| Melting Point | 199-202°C |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.408 |
| Flash Point | 255.4±25.2 °C |
| Exact Mass | 302.188202 |
| PSA | 54.37000 |
| LogP | 2.66 |
| Vapour Pressure | 0.0±2.7 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | OSVMTWJCGUFAOD-KZQROQTASA-N |
| SMILES | CC12CCC3C(CCC4=C(O)C(=O)CCC43C)C1CCC2=O |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H360 |
| Precautionary Statements | P201-P308 + P313 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic |
| Risk Phrases | R60 |
| Safety Phrases | S53-S36/37/39-S45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | BV8152500 |
|
Screening estrogenic activities of chemicals or mixtures in vivo using transgenic (cyp19a1b-GFP) zebrafish embryos.
PLoS ONE 7 , e36069, (2012) The tg(cyp19a1b-GFP) transgenic zebrafish expresses GFP (green fluorescent protein) under the control of the cyp19a1b gene, encoding brain aromatase. This gene has two major characteristics: (i) it is... |
|
|
Combined inhibitory effect of formestane and herceptin on a subpopulation of CD44+/CD24low breast cancer cells.
Cancer Sci. 101 , 1661-9, (2010) In breast cancer, stromal cells surrounding cancer epithelial cells can influence phenotype by producing paracrine factors. Among many mediators of epithelial-stromal interactions, aromatase activity ... |
|
|
The effects of aromatase inhibitors and selective estrogen receptor modulators on eye development in the zebrafish (Danio rerio).
Curr. Eye Res. 32(10) , 819-27, (2007) It has been shown that the steroid hormone estrogen plays an important role in the development of the central nervous system. The purpose of these studies was to determine the effect of estrogen on ze... |
| Androst-4-ene-3,17-dione, 4-hydroxy- |
| 4-Hydroxyandrost-4-ene-3,17-dione |
| 4-Hydroxy-4-androstene-3,17-dione |
| Formestane |
| B,Aromatase inhibitor |
| Lentaron |
| 4-androsten-4-ol-3,17-dione |
| 4-Hydroxyandrostenedione |
| 4-OH-A |
| MFCD00057814 |
| (8R,9S,10R,13S,14S)-4-hydroxy-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |