4-acetoxy-3-methoxybenzoyl chloride structure
|
Common Name | 4-acetoxy-3-methoxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 56681-66-4 | Molecular Weight | 228.62900 | |
| Density | 1.288g/cm3 | Boiling Point | 302.7ºC at 760 mmHg | |
| Molecular Formula | C10H9ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.2ºC | |
| Name | (4-carbonochloridoyl-2-methoxyphenyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 302.7ºC at 760 mmHg |
| Molecular Formula | C10H9ClO4 |
| Molecular Weight | 228.62900 |
| Flash Point | 125.2ºC |
| Exact Mass | 228.01900 |
| PSA | 52.60000 |
| LogP | 1.99950 |
| Index of Refraction | 1.526 |
| InChIKey | YRZKSSFRGXBQKU-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)Cl)ccc1OC(C)=O |
|
~%
4-acetoxy-3-met... CAS#:56681-66-4 |
| Literature: McKittrick, Brian A.; Stevenson, Robert Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 2 p. 475 - 482 |
|
~99%
4-acetoxy-3-met... CAS#:56681-66-4 |
| Literature: 3-Dimensional Pharmaceuticals, Inc. Patent: US6291514 B1, 2001 ; |
|
~%
4-acetoxy-3-met... CAS#:56681-66-4 |
| Literature: Gita, Haruhisa; Sobe, Yoshiaki; Akaku, Haruo; Ekine, Rena; Oto, Yuso; Isawa, Satoru; Hayashi, Hideya Bioorganic and Medicinal Chemistry Letters, 2001 , vol. 11, # 4 p. 549 - 551 |
| 3-methoxy-4-acetoxybenzoyl chloride |
| O-Acetyl-vanilloylchlorid |
| 3-Methoxy-4-acetoxybenzoylchlorid |
| 4-Acetoxy-3-methoxy-benzoylchlorid |
| 4-acetoxy-3-methoxy-benzoyl chloride |
| EINECS 260-336-0 |