4-Acetoxy-3-methoxyphenylacetic acid structure
|
Common Name | 4-Acetoxy-3-methoxyphenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 5447-38-1 | Molecular Weight | 224.21000 | |
| Density | 1.256g/cm3 | Boiling Point | 349.2ºC at 760mmHg | |
| Molecular Formula | C11H12O5 | Melting Point | 138-140ºC | |
| MSDS | N/A | Flash Point | 133.9ºC | |
| Name | 2-(4-acetyloxy-3-methoxyphenyl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 349.2ºC at 760mmHg |
| Melting Point | 138-140ºC |
| Molecular Formula | C11H12O5 |
| Molecular Weight | 224.21000 |
| Flash Point | 133.9ºC |
| Exact Mass | 224.06800 |
| PSA | 72.83000 |
| LogP | 1.24760 |
| Index of Refraction | 1.532 |
| InChIKey | QLJMBAXRCXCSGZ-UHFFFAOYSA-N |
| SMILES | COc1cc(CC(=O)O)ccc1OC(C)=O |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-O-acetylhomovanillic acid |
| 4-acetoxy-3-methoxyphenylacetic acid |
| acetylhomovanillic acid |
| 4-acetylhomovanilic acid |