N,N-diphenylsulfamoyl chloride structure
|
Common Name | N,N-diphenylsulfamoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 56751-83-8 | Molecular Weight | 267.73100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diphenylsulfamoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10ClNO2S |
|---|---|
| Molecular Weight | 267.73100 |
| Exact Mass | 267.01200 |
| PSA | 45.76000 |
| LogP | 4.38910 |
| InChIKey | MYCCMUDWFRCSME-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)N(c1ccccc1)c1ccccc1 |
|
~%
N,N-diphenylsul... CAS#:56751-83-8 |
| Literature: Abramovitch,R.A.; Miyashita,K. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1975 , p. 2413 - 2416 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Sulfamoyl chloride,diphenyl |
| Diphenylsulfamoylchlorid |
| diphenylsulfamoyl chloride |
| N,N-Diphenylsulfamoylchlorid |