1-(3-nitrophenyl)-N-phenyl-methanimine structure
|
Common Name | 1-(3-nitrophenyl)-N-phenyl-methanimine | ||
|---|---|---|---|---|
| CAS Number | 5676-82-4 | Molecular Weight | 226.23100 | |
| Density | 1.16g/cm3 | Boiling Point | 375.8ºC at 760 mmHg | |
| Molecular Formula | C13H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | 3-Nitro-benzaldehyd-(2-methyl-anil) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 375.8ºC at 760 mmHg |
| Molecular Formula | C13H10N2O2 |
| Molecular Weight | 226.23100 |
| Flash Point | 181.1ºC |
| Exact Mass | 226.07400 |
| PSA | 58.18000 |
| LogP | 3.86860 |
| Index of Refraction | 1.593 |
| InChIKey | FJAUVLILDZGNSX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Nc2ccccc2)c1 |
|
~97%
1-(3-nitropheny... CAS#:5676-82-4 |
| Literature: Pore, Santosh; Rashinkar, Gajanan; Mote, Kavita; Salunkhe, Rajeshri Chemistry and Biodiversity, 2010 , vol. 7, # 7 p. 1796 - 1800 |
|
~66%
1-(3-nitropheny... CAS#:5676-82-4 |
| Literature: Reddy, Marri Mahender; Kumar, Macharla Arun; Swamy, Peraka; Naresh, Mameda; Srujana, Kodumuri; Satyanarayana, Lanka; Venugopal, Akula; Narender, Nama Green Chemistry, 2013 , vol. 15, # 12 p. 3474 - 3483 |
|
~%
1-(3-nitropheny... CAS#:5676-82-4
Detail
|
| Literature: Ingold; Piggott Journal of the Chemical Society, 1922 , vol. 121, p. 2799 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| (3-nitrobenzylidene)phenylamine |
| N-(3-nitro-benzylidene)-o-toluidine |
| (3-nitrobenzylidene)aniline |
| (3-Nitro-benzal)-o-toluidin |
| N-(3-nitrobenzylidene)aniline |
| 2-Methyl-N-[(E)-(3-nitrophenyl)methylidene]aniline |
| (3-Nitro-benzylidene)-o-tolyl-amine |
| (3-Nitro-benzyliden)-anilin |
| N-(3-Nitro-benzyliden)-o-toluidin |
| 3-Nitro-benzaldehyd-phenylimin |
| 3-Nitro-benzaldehyd-o-tolylimin |
| 3-Nitro-benzaldehyd-anil |