5-(benzyloxy)-3-bromo-1H-indole structure
|
Common Name | 5-(benzyloxy)-3-bromo-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 569337-39-9 | Molecular Weight | 302.16600 | |
| Density | 1.49g/cm3 | Boiling Point | 459.023ºC at 760 mmHg | |
| Molecular Formula | C15H12BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.409ºC | |
| Name | 3-bromo-5-phenylmethoxy-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 459.023ºC at 760 mmHg |
| Molecular Formula | C15H12BrNO |
| Molecular Weight | 302.16600 |
| Flash Point | 231.409ºC |
| Exact Mass | 301.01000 |
| PSA | 25.02000 |
| LogP | 4.50940 |
| Index of Refraction | 1.689 |
| InChIKey | RGXOJKXWRRGKJN-UHFFFAOYSA-N |
| SMILES | Brc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-bromo-5-benzyloxyindole |