2-(3-carboxypropanoylamino)benzoic acid structure
|
Common Name | 2-(3-carboxypropanoylamino)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5694-37-1 | Molecular Weight | 237.20900 | |
| Density | 1.458g/cm3 | Boiling Point | 583.5ºC at 760 mmHg | |
| Molecular Formula | C11H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 306.7ºC | |
| Name | N-(3-carboxypropanoyl)-L-phenylalanine-p-nitroanilide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.458g/cm3 |
|---|---|
| Boiling Point | 583.5ºC at 760 mmHg |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.20900 |
| Flash Point | 306.7ºC |
| Exact Mass | 237.06400 |
| PSA | 103.70000 |
| LogP | 1.26110 |
| Index of Refraction | 1.635 |
| InChIKey | OGPDRYVIHAFSNL-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC(=O)Nc1ccccc1C(=O)O |
|
~95%
2-(3-carboxypro... CAS#:5694-37-1 |
| Literature: Balasubramaniyan, V.; Argade, N. P. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1988 , vol. 27, # 1-12 p. 906 - 908 |
|
~%
2-(3-carboxypro... CAS#:5694-37-1 |
| Literature: Snyder; Levin; Wiley Journal of the American Chemical Society, 1938 , vol. 60, p. 2025 |
|
~%
2-(3-carboxypro... CAS#:5694-37-1 |
| Literature: Auwers Justus Liebigs Annalen der Chemie, 1896 , vol. 292, p. 191 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3-carboxypropionyl)-L-phenylalanine p-nitroanilide |
| N-(3-Carboxy-propionyl)-anthranilsaeure |
| N-(3-carboxy-propionyl)-anthranilic acid |
| Suphepa |
| N-Succinoylanthranilsaeure |
| 2-(3-carboxy-1-oxo-propylamino)-benzoic acid |
| o-carboxysuccinanilic acid |
| N-succinyl-L-phenylalanine p-nitroanilide |
| (S)-4-({2-[(4-nitrophenyl)amino]-2-oxo-1-(phenylmethyl)ethyl}amino)-4-oxobutyric acid |
| Suc-Phe-pNA |
| 4-({1-[(4-nitrophenyl)amino]-1-oxo-3-phenylpropan-2-yl}amino)-4-oxobutanoic acid |
| Succinanilsaeure-carbonsaeure-(2) |
| N-(2-Carboxy-phenyl)-succinamidsaeure |