2-[(3-chlorophenyl)amino]-5-methoxy-benzoic acid structure
|
Common Name | 2-[(3-chlorophenyl)amino]-5-methoxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 56980-12-2 | Molecular Weight | 277.70300 | |
| Density | 1.361g/cm3 | Boiling Point | 435.1ºC at 760 mmHg | |
| Molecular Formula | C14H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217ºC | |
| Name | 2-(3-chloroanilino)-5-methoxybenzoic acid |
|---|
| Density | 1.361g/cm3 |
|---|---|
| Boiling Point | 435.1ºC at 760 mmHg |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.70300 |
| Flash Point | 217ºC |
| Exact Mass | 277.05100 |
| PSA | 58.56000 |
| LogP | 3.86340 |
| Index of Refraction | 1.647 |
| InChIKey | XIOQXUPGFMFNOF-UHFFFAOYSA-N |
| SMILES | COc1ccc(Nc2cccc(Cl)c2)c(C(=O)O)c1 |
|
~%
2-[(3-chlorophe... CAS#:56980-12-2 |
| Literature: Dauben Journal of the American Chemical Society, 1948 , vol. 70, p. 2420,2422 |
|
~%
2-[(3-chlorophe... CAS#:56980-12-2 |
| Literature: Friedheim; Bergmann Patent: US2389147 , 1943 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |