2-(3-chlorophenyl)sulfanyl-5-methoxy-benzoic acid structure
|
Common Name | 2-(3-chlorophenyl)sulfanyl-5-methoxy-benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 86455-99-4 | Molecular Weight | 294.75300 | |
| Density | 1.41g/cm3 | Boiling Point | 465ºC at 760mmHg | |
| Molecular Formula | C14H11ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 2-(3-chlorophenyl)sulfanyl-5-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760mmHg |
| Molecular Formula | C14H11ClO3S |
| Molecular Weight | 294.75300 |
| Flash Point | 235ºC |
| Exact Mass | 294.01200 |
| PSA | 71.83000 |
| LogP | 4.19800 |
| InChIKey | PYACVGUASHYTLP-UHFFFAOYSA-N |
| SMILES | COc1ccc(Sc2cccc(Cl)c2)c(C(=O)O)c1 |
|
~77%
2-(3-chlorophen... CAS#:86455-99-4 |
| Literature: Archer; Zayed; Rej; Rugino Journal of Medicinal Chemistry, 1983 , vol. 26, # 9 p. 1240 - 1246 |
|
Detail
|
| Literature: Sterling Winthrop Inc. Patent: US5346917 A1, 1994 ; |
|
~%
2-(3-chlorophen... CAS#:86455-99-4 |
| Literature: Archer; Zayed; Rej; Rugino Journal of Medicinal Chemistry, 1983 , vol. 26, # 9 p. 1240 - 1246 |
|
~%
2-(3-chlorophen... CAS#:86455-99-4 |
| Literature: SANOFI-SYNTHELABO Patent: EP1197491 A1, 2002 ; Location in patent: Page 20 ; |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| 3-Chloro-2'-carboxy-4'-methoxydiphenylsulfide |