11-Maleimidoundecanoic acid structure
|
Common Name | 11-Maleimidoundecanoic acid | ||
|---|---|---|---|---|
| CAS Number | 57079-01-3 | Molecular Weight | 281.347 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 452.8±18.0 °C at 760 mmHg | |
| Molecular Formula | C15H23NO4 | Melting Point | 89-90ºC | |
| MSDS | Chinese USA | Flash Point | 227.6±21.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of 11-Maleimidoundecanoic acid11-Maleimidoundecanoic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 11-(2,5-dioxopyrrol-1-yl)undecanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 11-Maleimidoundecanoic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.8±18.0 °C at 760 mmHg |
| Melting Point | 89-90ºC |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.347 |
| Flash Point | 227.6±21.2 °C |
| Exact Mass | 281.162720 |
| PSA | 74.68000 |
| LogP | 3.36 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | UVZTZBRGZXIBLZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCCCCN1C(=O)C=CC1=O |
| Storage condition | -20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2925190090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis of Heterotelechelic Polymers for Conjugation of Two Different Proteins.
Macromolecules 42 , 2360, (2009) In this report we describe a straightforward approach to synthesize polymers with end-groups that bind site-specifically to two different proteins. Telechelic biotin, maleimide poly(N-isopropylacrylam... |
|
|
Safak, M.; Alemdaroglu, F. E.; Li, Y.; Ergen, E.; Hernnann, A.
Adv. Mater. 19 , 1499, (2007)
|
| 11-(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)undecanoic acid |
| 11-maleimido-undecanoic acid |
| 1H-Pyrrole-1-undecanoic acid, 2,5-dihydro-2,5-dioxo- |
| UNII-LG78EY7HVB |
| maleimidoundecanoic acid |