Maleimide-C10-NHS ester structure
|
Common Name | Maleimide-C10-NHS ester | ||
|---|---|---|---|---|
| CAS Number | 87981-04-2 | Molecular Weight | 378.419 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 520.4±42.0 °C at 760 mmHg | |
| Molecular Formula | C19H26N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.5±27.9 °C | |
Use of Maleimide-C10-NHS esterMaleimide-C10-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 11-Maleimidoundecanoic Acid N-Succinimidyl Ester |
|---|---|
| Synonym | More Synonyms |
| Description | Maleimide-C10-NHS ester is an alkyl/ether-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 520.4±42.0 °C at 760 mmHg |
| Molecular Formula | C19H26N2O6 |
| Molecular Weight | 378.419 |
| Flash Point | 268.5±27.9 °C |
| Exact Mass | 378.179077 |
| PSA | 101.06000 |
| LogP | 1.84 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | SGNVTRHWJGTNKV-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCCCCN1C(=O)C=CC1=O)ON1C(=O)CCC1=O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| (2,5-dioxopyrrolidin-1-yl) 11-(2,5-dioxopyrrol-1-yl)undecanoate |
| 1-{11-[(2,5-Dioxo-1-pyrrolidinyl)oxy]-11-oxoundecyl}-1H-pyrrole-2,5-dione |