2-[[(3-chlorophenyl)amino]methyl]isoindole-1,3-dione structure
|
Common Name | 2-[[(3-chlorophenyl)amino]methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 57154-20-8 | Molecular Weight | 286.71300 | |
| Density | 1.437g/cm3 | Boiling Point | 484.9ºC at 760mmHg | |
| Molecular Formula | C15H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247ºC | |
| Name | 2-[(3-chloroanilino)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 484.9ºC at 760mmHg |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.71300 |
| Flash Point | 247ºC |
| Exact Mass | 286.05100 |
| PSA | 49.41000 |
| LogP | 3.01650 |
| InChIKey | MOZUUUFQJFCUHW-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CNc1cccc(Cl)c1 |
| HS Code | 2925190090 |
|---|
|
~%
2-[[(3-chloroph... CAS#:57154-20-8 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N-m-Chlorphenylaminomethyl-phthalimid |
| HMS557F22 |