2-[(4-methylphenyl)amino]naphthalene-1,4-dione structure
|
Common Name | 2-[(4-methylphenyl)amino]naphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 57182-49-7 | Molecular Weight | 263.29100 | |
| Density | 1.304g/cm3 | Boiling Point | 432.3ºC at 760 mmHg | |
| Molecular Formula | C17H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | 2-(4-methylphenyl)amino-1,4-naphthoquinone |
|---|
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 432.3ºC at 760 mmHg |
| Molecular Formula | C17H13NO2 |
| Molecular Weight | 263.29100 |
| Flash Point | 166.6ºC |
| Exact Mass | 263.09500 |
| PSA | 46.17000 |
| LogP | 3.44300 |
| Index of Refraction | 1.688 |
| InChIKey | DECIRKJAMAOVMR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC2=CC(=O)c3ccccc3C2=O)cc1 |
| Precursor 9 | |
|---|---|
| DownStream 2 | |
|
Name: Inhibition of human topoisomerase 2alpha assessed as reduction in decatenation of kin...
Source: ChEMBL
Target: DNA topoisomerase 2-alpha
External Id: CHEMBL4810483
|
|
Name: Cytotoxicity against human MCF7 cells assessed as reduction in cell viability incubat...
Source: ChEMBL
Target: MCF7
External Id: CHEMBL4810486
|
|
Name: Cytotoxicity against human H357 cells assessed as reduction in cell viability incubat...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4810487
|
|
Name: Cytotoxicity against human HEK293T cells assessed as reduction in cell viability incu...
Source: ChEMBL
Target: HEK-293T
External Id: CHEMBL4810484
|
|
Name: Cytotoxicity against human MDA-MB-231 cells assessed as reduction in cell viability i...
Source: ChEMBL
Target: MDA-MB-231
External Id: CHEMBL4810485
|