1H-Benzimidazol-2-acetonitrile, alpha-((4-(dimethylamino)phenyl)methylene)- structure
|
Common Name | 1H-Benzimidazol-2-acetonitrile, alpha-((4-(dimethylamino)phenyl)methylene)- | ||
|---|---|---|---|---|
| CAS Number | 57319-74-1 | Molecular Weight | 288.34600 | |
| Density | 1.256g/cm3 | Boiling Point | 533.2ºC at 760 mmHg | |
| Molecular Formula | C18H16N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.3ºC | |
| Name | (E)-2-(1H-benzimidazol-2-yl)-3-[4-(dimethylamino)phenyl]prop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.256g/cm3 |
|---|---|
| Boiling Point | 533.2ºC at 760 mmHg |
| Molecular Formula | C18H16N4 |
| Molecular Weight | 288.34600 |
| Flash Point | 276.3ºC |
| Exact Mass | 288.13700 |
| PSA | 55.71000 |
| LogP | 3.69308 |
| Index of Refraction | 1.728 |
| InChIKey | SHZAKAMMDOHBMT-SDNWHVSQSA-N |
| SMILES | CN(C)c1ccc(C=C(C#N)c2nc3ccccc3[nH]2)cc1 |
|
~82%
1H-Benzimidazol... CAS#:57319-74-1 |
| Literature: Liu, Shuo; Ni, Yuxiang; Wei, Wenjing; Qiu, Fangli; Xu, Songlin; Ying, Anguo Journal of Chemical Research, 2014 , vol. 38, # 3 p. 186 - 188 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(1H-benzoimidazol-2-yl)-3-(4-dimethylamino-phenyl)-acrylonitrile |
| 2-(2-benzimidazolyl)-3-(4-N,N-dimethylaminophenyl)acrylonitrile |