methyl 2-carbamoyl-3-phenylpropionate structure
|
Common Name | methyl 2-carbamoyl-3-phenylpropionate | ||
|---|---|---|---|---|
| CAS Number | 57355-27-8 | Molecular Weight | 207.22600 | |
| Density | 1.174g/cm3 | Boiling Point | 388ºC at 760mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | methyl 3-amino-2-benzyl-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.174g/cm3 |
|---|---|
| Boiling Point | 388ºC at 760mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 201.7ºC |
| Exact Mass | 207.09000 |
| PSA | 70.38000 |
| LogP | 1.65330 |
| Index of Refraction | 1.535 |
| InChIKey | MBGQTVLDUWAMMN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Cc1ccccc1)C(N)=O |
| HS Code | 2924299090 |
|---|
|
~%
methyl 2-carbam... CAS#:57355-27-8 |
| Literature: Sacripante, Guerino; Tan, Charles; Just, George Tetrahedron Letters, 1985 , vol. 26, # 46 p. 5643 - 5646 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 260-691-1 |
| methyl 2-carbamoyl-3-phenylpropionate |
| Methyl 2-benzylmalonamate |
| Benzylmalonatemethyl ester monoamide |