5-Bromo-3-nitropyridine-2-carbonitrile structure
|
Common Name | 5-Bromo-3-nitropyridine-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 573675-25-9 | Molecular Weight | 228.003 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 348.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C6H2BrN3O2 | Melting Point | 101-106ºC | |
| MSDS | Chinese USA | Flash Point | 164.8±27.9 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 5-Bromo-3-nitropicolinonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 348.9±42.0 °C at 760 mmHg |
| Melting Point | 101-106ºC |
| Molecular Formula | C6H2BrN3O2 |
| Molecular Weight | 228.003 |
| Flash Point | 164.8±27.9 °C |
| Exact Mass | 226.933029 |
| PSA | 82.50000 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | OBVYONPVHIOJJZ-UHFFFAOYSA-N |
| SMILES | N#Cc1ncc(Br)cc1[N+](=O)[O-] |
| Storage condition | Room temperature. |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H318-H332-H335 |
| Precautionary Statements | P261-P280-P301 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;Xi: Irritant; |
| Risk Phrases | R20/21;R25;R37/38;R41 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2811 6.1/PG 3 |
| HS Code | 2933399090 |
|
~60%
5-Bromo-3-nitro... CAS#:573675-25-9 |
| Literature: EP1757594 A1, ; Page/Page column 76 ; EP 1757594 A1 |
|
~%
5-Bromo-3-nitro... CAS#:573675-25-9 |
| Literature: WO2005/63690 A1, ; Page/Page column 29 ; WO 2005/063690 A1 |
|
~%
5-Bromo-3-nitro... CAS#:573675-25-9 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 13 p. 3608 - 3612 |
|
~%
5-Bromo-3-nitro... CAS#:573675-25-9 |
| Literature: Journal of the Chemical Society, , p. 2042,2044 |
|
~%
5-Bromo-3-nitro... CAS#:573675-25-9 |
| Literature: Journal of the Chemical Society, , p. 2042,2044 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyridinecarbonitrile, 5-bromo-3-nitro- |
| 5-Bromo-3-nitropyridine-2-carbonitrile |
| MFCD06657551 |
| 5-Bromo-2-cyano-3-nitropyridine |
| 5-Bromo-3-nitro-2-pyridinecarbonitrile |