N-(pyridin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide
Modify Date: 2025-08-25 19:11:31
N-(pyridin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide structure
|
Common Name | N-(pyridin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide | ||
|---|---|---|---|---|
| CAS Number | 57415-36-8 | Molecular Weight | 408.29500 | |
| Density | 1.372g/cm3 | Boiling Point | 441.1ºC at 760mmHg | |
| Molecular Formula | C17H14F6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.6ºC | |
| Name | N-(pyridin-2-ylmethyl)-2,5-bis(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.372g/cm3 |
|---|---|
| Boiling Point | 441.1ºC at 760mmHg |
| Molecular Formula | C17H14F6N2O3 |
| Molecular Weight | 408.29500 |
| Flash Point | 220.6ºC |
| Exact Mass | 408.09100 |
| PSA | 60.45000 |
| LogP | 4.28470 |
| Index of Refraction | 1.489 |
| InChIKey | YCKWLOJVFNPJAW-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccn1)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| HS Code | 2933399090 |
|---|
|
~93%
N-(pyridin-2-yl... CAS#:57415-36-8 |
| Literature: Geneva Pharmaceuticals, Inc. Patent: US6458957 B1, 2002 ; |
|
~%
N-(pyridin-2-yl... CAS#:57415-36-8 |
| Literature: US4617396 A1, ; |
|
~%
N-(pyridin-2-yl... CAS#:57415-36-8 |
| Literature: WO2007/3982 A1, ; Page/Page column 7 ; |
CAS#:54143-56-5| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 260-729-7 |
| Flecainide Impurity |