2,5-Di(2,2,2-trifluoroethoxy)benzoic acid
2,5-Di(2,2,2-trifluoroethoxy)benzoic acid structure
|
Common Name | 2,5-Di(2,2,2-trifluoroethoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 35480-52-5 | Molecular Weight | 318.169 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 320.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H8F6O4 | Melting Point | 119-121ºC | |
| MSDS | N/A | Flash Point | 147.9±27.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.9±42.0 °C at 760 mmHg |
| Melting Point | 119-121ºC |
| Molecular Formula | C11H8F6O4 |
| Molecular Weight | 318.169 |
| Flash Point | 147.9±27.9 °C |
| Exact Mass | 318.032684 |
| PSA | 55.76000 |
| LogP | 3.60 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.439 |
| InChIKey | YPGYLCZBZKRYQJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36-36/37/39 |
| HS Code | 2918990090 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 3 | |
CAS#:75-89-8
CAS#:21739-92-4
CAS#:1023951-32-7
CAS#:35480-31-0
CAS#:57415-36-8
CAS#:50778-59-1This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,5-bis(2,2,2-trifluoroethoxy)benzoic acid (intermediate of flecainide acetate) |
| Flecainide Acetate IMpurity D |
| FXFF1OR BVQ DO1XFFF |
| 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid |
| 2,5-Di(2,2,2-trifluoroethoxy)benzoic acid |
| 2,5-BIS(TRIFLUOROETHOXY)BENZOIC ACID |
| 2,5-Di(2,2,2-Trifluoroethoxy)B |
| BENZOIC ACID,2,5-BIS(2,2,2-TRIFLUOROETHOXY) |
| MFCD00221424 |
| 2.5-Bis-(2.2.2-trifluoroethoxy)-benzoesaeure |
| 2,4-DICHLORO-5-DIETHYLSULFAMOYL-BENZOIC ACID |
| 2,5-bis (2,2,2-trifluoroethoxy)benzoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Polar surface area (PSA) of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is 55.76000. |
| Q: What are the upstream materials of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Related upstream materials(CAS) of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid: 75-89-8;21739-92-4;1023951-32-7. |
| Q: What are the downstream products of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Related downstream products(CAS) of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid: 35480-31-0;57415-36-8;50778-59-1. |
| Q: What is the molecular weight of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Molecular weight of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is 318.169. |
| Q: What is the LogP of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: LogP of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is 3.60. |
| Q: What is the safety information for 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Safety information for 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid: 26-36-36/37/39. |
| Q: What is the molecular formula of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Molecular formula of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is C11H8F6O4. |
| Q: What is the CAS number of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: CAS number of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is 35480-52-5. |
| Q: What is the boiling point of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Boiling point of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is 320.9±42.0 °C at 760 mmHg. |
| Q: What is the melting point of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid? |
| A: Melting point of 2,5-Bis(2,2,2-trifluoroethoxy)benzoic acid is 119-121ºC. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |