Withaphysalin A
Modify Date: 2025-08-25 17:36:09
Withaphysalin A structure
|
Common Name | Withaphysalin A | ||
|---|---|---|---|---|
| CAS Number | 57423-72-0 | Molecular Weight | 466.56600 | |
| Density | 1.30±0.1 g/cm3(Predicted) | Boiling Point | 699.1±55.0 °C(Predicted) | |
| Molecular Formula | C28H34O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Withaphysalin AWithaphysalin A is a withanolide-type compound. Withaphysalin A can be obtained from the anti-inflammatory fraction of P. minima. Withaphysalin A can be used for the research of inflammation[1]. |
| Name | Withaphysalin D |
|---|
| Description | Withaphysalin A is a withanolide-type compound. Withaphysalin A can be obtained from the anti-inflammatory fraction of P. minima. Withaphysalin A can be used for the research of inflammation[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.30±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 699.1±55.0 °C(Predicted) |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.56600 |
| Exact Mass | 466.23600 |
| PSA | 89.90000 |
| LogP | 3.97290 |
| InChIKey | XXDCTQHRVNTDTI-OZKLRMFXSA-N |
| SMILES | CC1=C(C)C(=O)OC(C2(C)OC(=O)C34CCC5C(CC=C6CC=CC(=O)C65C)C3(O)CCC24)C1 |