ethyl 3-(4-biphenyl)-3-oxopropanoate structure
|
Common Name | ethyl 3-(4-biphenyl)-3-oxopropanoate | ||
|---|---|---|---|---|
| CAS Number | 57477-98-2 | Molecular Weight | 268.307 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 391.8±17.0 °C at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.1±21.0 °C | |
| Name | ethyl 3-oxo-3-(4-phenylphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 391.8±17.0 °C at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.307 |
| Flash Point | 172.1±21.0 °C |
| Exact Mass | 268.109955 |
| PSA | 43.37000 |
| LogP | 3.72 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | MJCRLYUYIXGGAX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(-c2ccccc2)cc1 |
| HS Code | 2918300090 |
|---|
|
~78%
ethyl 3-(4-biph... CAS#:57477-98-2 |
| Literature: WO2005/85221 A1, ; Page/Page column 70 ; WO 2005/085221 A1 |
|
~70%
ethyl 3-(4-biph... CAS#:57477-98-2 |
| Literature: Chemistry - A European Journal, , vol. 10, # 6 p. 1445 - 1455 |
|
~79%
ethyl 3-(4-biph... CAS#:57477-98-2 |
| Literature: Angewandte Chemie - International Edition, , vol. 52, # 37 p. 9763 - 9766 Angew. Chem., , vol. 125, # 37 p. 9945 - 9948 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl 3-(4-biphenyl)-3-oxopropanoate |
| AC-7797 |
| ethyl 4-phenylbenzoylacetate |
| Ethyl 3-(4-biphenylyl)-3-oxopropanoate |
| b-Oxo-biphenyl-4-propanoic acid ethyl ester |
| Ethyl 3-(biphenyl-4-yl)-3-oxopropanoate |
| [1,1'-Biphenyl]-4-propanoic acid, β-oxo-, ethyl ester |
| 3-Biphenyl-4-yl-3-oxopropionic acid ethyl ester |