Thromboxane A2 structure
|
Common Name | Thromboxane A2 | ||
|---|---|---|---|---|
| CAS Number | 57576-52-0 | Molecular Weight | 352.46500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Thromboxane A2Thromboxane A2 (TXA2) is a prostanoid mediator produced by the metabolism of Arachidonic acid (HY-109590) through the cyclooxygenase pathway. Thromboxane A2 activates the thromboxane-prostanoid (TP) receptors. Thromboxane A2 is a potent vasoconstrictor eicosanoid. Thromboxane A2 (TXA2) leads to potent vasoconstriction by stimulation of smooth muscle cells. Thromboxane A2 acts as s tonic immunoregulator to regulate adaptive immune responses[1][2]. |
| Name | thromboxane A2 |
|---|
| Description | Thromboxane A2 (TXA2) is a prostanoid mediator produced by the metabolism of Arachidonic acid (HY-109590) through the cyclooxygenase pathway. Thromboxane A2 activates the thromboxane-prostanoid (TP) receptors. Thromboxane A2 is a potent vasoconstrictor eicosanoid. Thromboxane A2 (TXA2) leads to potent vasoconstriction by stimulation of smooth muscle cells. Thromboxane A2 acts as s tonic immunoregulator to regulate adaptive immune responses[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite TP |
| References |
| Molecular Formula | C20H32O5 |
|---|---|
| Molecular Weight | 352.46500 |
| Exact Mass | 352.22500 |
| PSA | 75.99000 |
| LogP | 3.81500 |
| InChIKey | DSNBHJFQCNUKMA-SCKDECHMSA-N |
| SMILES | CCCCCC(O)C=CC1OC2CC(O2)C1CC=CCCCC(=O)O |