2-NITRO-5-(PROPYLTHIO)ANILINE structure
|
Common Name | 2-NITRO-5-(PROPYLTHIO)ANILINE | ||
|---|---|---|---|---|
| CAS Number | 57780-75-3 | Molecular Weight | 212.26900 | |
| Density | 1.25g/cm3 | Boiling Point | 380.3ºC at 760mmHg | |
| Molecular Formula | C9H12N2O2S | Melting Point | 71-74ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 183.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-nitro-5-propylsulfanylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 380.3ºC at 760mmHg |
| Melting Point | 71-74ºC(lit.) |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.26900 |
| Flash Point | 183.8ºC |
| Exact Mass | 212.06200 |
| PSA | 97.14000 |
| LogP | 3.78350 |
| Index of Refraction | 1.607 |
| InChIKey | NLCPQMUVBQILMA-UHFFFAOYSA-N |
| SMILES | CCCSc1ccc([N+](=O)[O-])c(N)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2930909090 |
|
~99%
2-NITRO-5-(PROP... CAS#:57780-75-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 11, # 21 p. 4615 - 4622 |
|
~%
2-NITRO-5-(PROP... CAS#:57780-75-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 18 p. 2231 - 2236 |
|
~%
2-NITRO-5-(PROP... CAS#:57780-75-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 6, # 18 p. 2231 - 2236 |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-nitro-5-(propylthio)aniline |
| 2-nitro5-propylthioanaline |
| Benzenamine,2-nitro-5-(propylthio) |
| 2-Nitro-5-propylthioanilin |
| MFCD00192355 |
| 2-nitro-5-n-propylthioaniline |
| 2-nitro-5-propanylthioaniline |