Closantel structure
|
Common Name | Closantel | ||
|---|---|---|---|---|
| CAS Number | 57808-65-8 | Molecular Weight | 663.074 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 590.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H14Cl2I2N2O2 | Melting Point | 210 - 22ºC | |
| MSDS | USA | Flash Point | 310.9±30.1 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of ClosantelClosantel is a salicylanilide anthelmintic compound; exhibits different anthelmintic spectra and apparent toxicity in mammals. |
| Name | closantel |
|---|---|
| Synonym | More Synonyms |
| Description | Closantel is a salicylanilide anthelmintic compound; exhibits different anthelmintic spectra and apparent toxicity in mammals. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 590.5±50.0 °C at 760 mmHg |
| Melting Point | 210 - 22ºC |
| Molecular Formula | C22H14Cl2I2N2O2 |
| Molecular Weight | 663.074 |
| Flash Point | 310.9±30.1 °C |
| Exact Mass | 661.852173 |
| PSA | 73.12000 |
| LogP | 9.08 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | JMPFSEBWVLAJKM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c1cc(I)cc(I)c1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H413 |
| Precautionary Statements | P301 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn |
| Risk Phrases | R22 |
| RIDADR | 2811 |
| RTECS | CV2444250 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
|
~%
Closantel CAS#:57808-65-8 |
| Literature: US4005218 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
|
The efficacy of trichlorphon and naphthalophos against multiple anthelmintic-resistant nematodes of naturally infected sheep in Argentina.
Parasitol. Res. 109 Suppl 1 , S139-48, (2011) An anthelmintic efficacy trial was conducted in sheep harbouring anthelmintic-resistant worms in Argentina. Seventy lambs were selected from a flock that had been grazed on pastures infected with tric... |
|
|
Emergency slaughter of casualty cattle increases the prevalence of anthelmintic drug residues in muscle.
Food Addit. Contam. Part A. Chem. Anal. Control. Expo. Risk Assess. 29(8) , 1263-71, (2012) The ProSafeBeef project studied the prevalence of residues of anthelmintic drugs used to control parasitic worms and fluke in beef cattle in Ireland. Injured (casualty) cattle may enter the human food... |
|
|
An improved thyroid hormone reporter assay to determine the thyroid hormone-like activity of amiodarone, bithionol, closantel and rafoxanide.
Toxicol. Lett. 208(1) , 30-5, (2012) A number of environmental chemicals have been reported to exhibit thyroid hormone-like activity. Since thyroid hormones play a crucial role in development, it is important to identify chemicals in the... |
| MFCD00661151 |
| Closantel |
| N-{5-Chloro-4-[(4-chlorophenyl)(cyano)methyl]-2-methylphenyl}-2-hydroxy-3,5-diiodobenzamide |
| rac-N-[5-chloro-4-[(R)-(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| N-[5-Chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| (RS)-5’-chloro-4’-(4-chloro-α-cyanobenzyl)-3,5-diiodosalicyl-o-toluidide |
| N-{5-Chlor-4-[(4-chlorphenyl)(cyan)methyl]-2-methylphenyl}-2-hydroxy-3,5-diiodbenzolcarboxamid |
| N-(5-Chloro-4-((4-chlorophenyl)(cyano)methyl)-2-methylphenyl)-2-hydroxy-3,5-diiodobenzamide |
| Benzamide, N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodo- |
| UNII:EUL532EI54 |
| EINECS 260-967-1 |