Cardionogen 2 structure
|
Common Name | Cardionogen 2 | ||
|---|---|---|---|---|
| CAS Number | 578755-52-9 | Molecular Weight | 343.404 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 501.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C16H17N5O2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 257.4±32.9 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of Cardionogen 2Cardionogen 2 (CDNG2) is a small molecule that promotes cardiomyocyte generation by modulating Wnt signaling. |
| Name | 2-(3,4-Dimethoxyphenyl)-5-(2-pyridinyl)-2,3,5,6-tetrahydro[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 501.9±60.0 °C at 760 mmHg |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.404 |
| Flash Point | 257.4±32.9 °C |
| Exact Mass | 343.110291 |
| LogP | 1.10 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.701 |
| InChIKey | MEWRLQUBVOVSGN-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2nn3c(-c4ccccn4)nnc3s2)cc1OC |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | P301 + P310 |
| RIDADR | UN 2811 6.1 / PGIII |
| 1,2,4-Triazolo[3,4-b][1,3,4]thiadiazole, 2-(3,4-dimethoxyphenyl)-2,3,5,6-tetrahydro-5-(2-pyridinyl)- |
| 2-(3,4-Dimethoxyphenyl)-5-(2-pyridinyl)-2,3,5,6-tetrahydro[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |