N-[(2-hydroxy-5-nitro-phenyl)methyl]acetamide structure
|
Common Name | N-[(2-hydroxy-5-nitro-phenyl)methyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 5804-36-4 | Molecular Weight | 210.18700 | |
| Density | 1.356g/cm3 | Boiling Point | 526.4ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.2ºC | |
| Name | N-[(2-hydroxy-5-nitrophenyl)methyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.356g/cm3 |
|---|---|
| Boiling Point | 526.4ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 272.2ºC |
| Exact Mass | 210.06400 |
| PSA | 95.15000 |
| LogP | 1.85060 |
| Index of Refraction | 1.592 |
| InChIKey | SKIMPHYSGGMGFO-UHFFFAOYSA-N |
| SMILES | CC(=O)NCc1cc([N+](=O)[O-])ccc1O |
|
~%
N-[(2-hydroxy-5... CAS#:5804-36-4 |
| Literature: Wella Aktiengesellschaft Patent: US4797130 A1, 1989 ; |
|
~%
N-[(2-hydroxy-5... CAS#:5804-36-4 |
| Literature: Ishidate,M. et al. Chemische Berichte, 1960 , vol. 93, p. 2898 - 2902 |
|
~%
N-[(2-hydroxy-5... CAS#:5804-36-4 |
|
Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society [Section] C: Organic, 1966 , vol. |
| 2-Acetaminomethyl-4-nitro-phenol |
| 2-acetamidomethyl-4-nitro-phenol |
| 4-Nitro-2-acetaminomethyl-phenol |
| 2-acetylaminomethyl-4-nitrophenol |