Methanediol, 1-phenyl-,1,1-diacetate structure
|
Common Name | Methanediol, 1-phenyl-,1,1-diacetate | ||
|---|---|---|---|---|
| CAS Number | 581-55-5 | Molecular Weight | 208.21100 | |
| Density | 1.106g/cm3 | Boiling Point | 154 °C / 20mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | 44-46°C | |
| MSDS | N/A | Flash Point | 105.7ºC | |
| Name | Benzal Diacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 154 °C / 20mmHg |
| Melting Point | 44-46°C |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21100 |
| Flash Point | 105.7ºC |
| Exact Mass | 208.07400 |
| PSA | 52.60000 |
| LogP | 1.81140 |
| Index of Refraction | 1.505 |
| InChIKey | XRYSDRCNTMEYFH-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(OC(C)=O)c1ccccc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37:Irritating to eyes and respiratory system . |
| Safety Phrases | S22-S26-S37/39 |
| WGK Germany | 3 |
| RTECS | VV9170000 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00059206 |
| [acetyloxy(phenyl)methyl] acetate |
| EINECS 209-469-8 |