2-(benzoyloxymethyl)benzoic acid
Modify Date: 2025-08-23 13:35:53
2-(benzoyloxymethyl)benzoic acid structure
|
Common Name | 2-(benzoyloxymethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 58249-83-5 | Molecular Weight | 256.25300 | |
| Density | 1.277g/cm3 | Boiling Point | 425ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | 126-129ºC | |
| MSDS | Chinese USA | Flash Point | 160.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(benzoyloxymethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 425ºC at 760 mmHg |
| Melting Point | 126-129ºC |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 160.8ºC |
| Exact Mass | 256.07400 |
| PSA | 63.60000 |
| LogP | 2.74180 |
| Index of Refraction | 1.609 |
| InChIKey | QDENBWUYSUBCID-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccccc1C(=O)O)c1ccccc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918990090 |
|
~25%
2-(benzoyloxyme... CAS#:58249-83-5 |
| Literature: Rachwalski, Michal; Jarzynski, Szymon; Lesniak, Stanislaw Tetrahedron Asymmetry, 2013 , vol. 24, # 7 p. 421 - 425 |
CAS#:6754-94-5
CAS#:58249-87-9
CAS#:58249-89-1| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-benzoyloxymethylbenzoic acid |
| Einecs 261-185-3 |