Hydrazinecarboxamide,2-[(4-hydroxyphenyl)methylene]- structure
|
Common Name | Hydrazinecarboxamide,2-[(4-hydroxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 58336-40-6 | Molecular Weight | 179.17600 | |
| Density | 1.431g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(4-oxocyclohexa-2,5-dien-1-ylidene)methylamino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.431g/cm3 |
|---|---|
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.17600 |
| Exact Mass | 179.06900 |
| PSA | 87.71000 |
| LogP | 1.48560 |
| Index of Refraction | 1.704 |
| InChIKey | VDPCABXJOAHHDE-BJMVGYQFSA-N |
| SMILES | C1=CC(=CC=C1/C=N/NC(=O)N)O |
| HS Code | 2928000090 |
|---|
|
~78%
Hydrazinecarbox... CAS#:58336-40-6 |
| Literature: Rajak, Harish; Kharya, Murli Dhar; Mishra, Pradeep Archiv der Pharmazie, 2008 , vol. 341, # 4 p. 247 - 261 |
|
~88%
Hydrazinecarbox... CAS#:58336-40-6 |
| Literature: Bandgar, Babasaheb P.; Sadavarte, Vaibhav S.; Uppalla, Lav S.; Govande, Rahul Monatshefte fur Chemie, 2001 , vol. 132, # 3 p. 403 - 406 |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| p-Hydroxybenzaldehyd-Semicarbazon |
| 4-hydroxybenzaldehyde semicarbazone |
| p-Hydroxybenzaldehyde semicarbazone |
| 4-Hydroxy-benzaldehyd-semicarbazon |
| 4-hydroxybenzal semicarbazone |
| p-hydroxybenzaldehyde semicarbazone ester |