Uvaretin structure
|
Common Name | Uvaretin | ||
|---|---|---|---|---|
| CAS Number | 58449-06-2 | Molecular Weight | 378.42 | |
| Density | 1.274g/cm3 | Boiling Point | 620.2ºC at 760 mmHg | |
| Molecular Formula | C23H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.8ºC | |
Use of UvaretinA mixture of uvaretin and isouvaretin (HY-N10130) exhibits significant antibacterial activity against B. subtilis (EC50 8.7 μM) and S. epidermidis (IC50 7.9 μM). |
| Name | 1-[2,4-dihydroxy-3-[(2-hydroxyphenyl)methyl]-6-methoxyphenyl]-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Description | A mixture of uvaretin and isouvaretin (HY-N10130) exhibits significant antibacterial activity against B. subtilis (EC50 8.7 μM) and S. epidermidis (IC50 7.9 μM). |
|---|---|
| Related Catalog | |
| References |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 620.2ºC at 760 mmHg |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 |
| Flash Point | 217.8ºC |
| Exact Mass | 378.14700 |
| PSA | 86.99000 |
| LogP | 4.21830 |
| Index of Refraction | 1.64 |
| InChIKey | LQHGGFQNRNEFIG-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(Cc2ccccc2O)c(O)c1C(=O)CCc1ccccc1 |
| Precursor 6 | |
|---|---|
| DownStream 4 | |
| Uvaretin |