Uvaretin dimethyl ether structure
|
Common Name | Uvaretin dimethyl ether | ||
|---|---|---|---|---|
| CAS Number | 58449-09-5 | Molecular Weight | 406.47100 | |
| Density | 1.167g/cm3 | Boiling Point | 597.1ºC at 760 mmHg | |
| Molecular Formula | C25H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
| Name | 1-[2-hydroxy-4,6-dimethoxy-3-[(2-methoxyphenyl)methyl]phenyl]-3-phenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 597.1ºC at 760 mmHg |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.47100 |
| Flash Point | 202.8ºC |
| Exact Mass | 406.17800 |
| PSA | 64.99000 |
| LogP | 4.82430 |
| Index of Refraction | 1.585 |
| InChIKey | QJGSKRRLEMYSNU-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Cc1c(OC)cc(OC)c(C(=O)CCc2ccccc2)c1O |
| HS Code | 2914509090 |
|---|
|
~%
Uvaretin dimeth... CAS#:58449-09-5 |
| Literature: Lasswell,W.L.; Hufford,C.D. Journal of Organic Chemistry, 1977 , vol. 42, # 8 p. 1295 - 1302 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Uvaretin,O-dimethyl |
| Uvaretin dimethyl ether |