Lariciresinol dimethyl ether structure
|
Common Name | Lariciresinol dimethyl ether | ||
|---|---|---|---|---|
| CAS Number | 67560-68-3 | Molecular Weight | 388.454 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 528.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C22H28O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.4±30.1 °C | |
| Name | [(2S,3R,4R)-2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]oxolan-3-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 528.4±50.0 °C at 760 mmHg |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.454 |
| Flash Point | 273.4±30.1 °C |
| Exact Mass | 388.188599 |
| PSA | 66.38000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | AYWPHVUFQNWITL-PNLZDCPESA-N |
| SMILES | COc1ccc(CC2COC(c3ccc(OC)c(OC)c3)C2CO)cc1OC |
| Hazard Codes | Xi |
|---|
|
~%
Lariciresinol d... CAS#:67560-68-3 |
| Literature: Tanaka, Hitoshi; Nakamura, Takeshi; Ichino, Kazuhiko; Ito, Kazuo Phytochemistry (Elsevier), 1989 , vol. 28, # 3 p. 952 - 954 |
|
~%
Lariciresinol d... CAS#:67560-68-3 |
| Literature: Riaz, Muhammad; Ullah, Nisar; Mehmood, Arshad; Nawaz, Hafiz Rab; Malik, Abdul; Afza, Nighat Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2000 , vol. 55, # 12 p. 1216 - 1220 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [(2S,3R,4R)-4-(3,4-Dimethoxybenzyl)-2-(3,4-dimethoxyphenyl)tetrahydro-3-furanyl]methanol |
| lariciresinol dimethylether |
| 3-Furanmethanol, 2-(3,4-dimethoxyphenyl)-4-[(3,4-dimethoxyphenyl)methyl]tetrahydro-, (2S,3R,4R)- |
| Lariciresinol dimethyl ether |