3-Chloro-4-pyrrolidinobenzoic Acid structure
|
Common Name | 3-Chloro-4-pyrrolidinobenzoic Acid | ||
|---|---|---|---|---|
| CAS Number | 585517-09-5 | Molecular Weight | 225.67100 | |
| Density | 1.339g/cm3 | Boiling Point | 396.4ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.5ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3-Chloro-4-pyrrolidinobenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.339g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67100 |
| Flash Point | 193.5ºC |
| Exact Mass | 225.05600 |
| PSA | 40.54000 |
| LogP | 2.70340 |
| Index of Refraction | 1.608 |
| InChIKey | ICTYJBKSXOEFEB-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N2CCCC2)c(Cl)c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H318 |
| Precautionary Statements | P280-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
|
~%
3-Chloro-4-pyrr... CAS#:585517-09-5 |
| Literature: WO2008/128951 A1, ; Page/Page column 59-60 ; WO 2008/128951 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-chloro-4-pyrrolidin-1-ylbenzoic acid |