DL-10-Camphorsulfonic Acid structure
|
Common Name | DL-10-Camphorsulfonic Acid | ||
|---|---|---|---|---|
| CAS Number | 5872-08-2 | Molecular Weight | 232.297 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H16O4S | Melting Point | 203-206ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | DL-10-Camphorsulfonic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 203-206ºC |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.297 |
| Exact Mass | 232.076935 |
| PSA | 79.82000 |
| LogP | -0.57 |
| Index of Refraction | 1.540 |
| InChIKey | MIOPJNTWMNEORI-UHFFFAOYSA-N |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2 |
| Storage condition | 2-8°C |
| Stability | Stable. Incompatible with strong bases, strong oxidizing agents. Combustible. |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P260-P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3261 |
| WGK Germany | 3 |
| RTECS | DT5077100 |
| Packaging Group | III |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Analysis of deprotonated acids with silicon nanoparticle-assisted laser desorption/ ionization mass spectrometry.
J. Mass Spectrom. 45(12) , 1394-401, (2010) Chemically modified silicon nanoparticles were applied for the laser desorption/negative ionization of small acids. A series of substituted sulfonic acids and fatty acids was studied. Compared to deso... |
|
|
Camphorsulfonic acid catalysed facile tandem double Friedlander annulation protocol for the synthesis of phenoxy linked bisquinoline derivatives and discovery of antitubercular agents.
Bioorg. Med. Chem. Lett. 22 , 1643-8, (2012) A series of phenoxy linked bisquinoline derivatives were synthesised from the Friedlander annulation of 2-(4-acetylphenoxy)-1-aryl-1-ethanones with 2-aminobenzophenone in good yields using (±)-camphor... |
|
|
Design and construction of a compact end-station at NSRRC for circular-dichroism spectra in the vacuum-ultraviolet region.
J. Synchrotron Radiat. 17(6) , 761-8, (2010) A synchrotron-radiation-based circular-dichroism end-station has been implemented at beamline BL04B at the National Synchrotron Radiation Research Center (NSRRC) in Taiwan for biological research. The... |
| MFCD00074827 |
| EINECS 227-527-0 |
| 10-Bornanesulfonic acid, 2-oxo-, (1S,4R)-(+)- |
| b-Camphorsulfonic Acid |
| UNII:D8D049375Q |
| D-CAMPHORSULFONIC ACID |
| (1S)-Camphor-10-sulfonic acid |
| D-(+)-10-Camphorsulfonic Acid |
| (+)-Camphor-w-sulfonic Acid |
| (+)-D-Camphor-10-sulfonic Acid |
| CSA |
| camphersulfosaeure |
| Camphorsulfonic acid |
| Camphostyl |
| (1S)-(+)-CAMPHOR-10-SULPHONIC ACIDCamphorSulfonic Acid |
| D-Camphor-10-Sulfonic Acid |
| Bicyclo(2.2.1)heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- |
| [(1R,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid |
| Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1R,4R)- |
| (1S)-(+)-10-Camphors |
| (+)-b-Camphorsulfonic Acid |
| (+)-(S)-Camphor-10-sulfonic Acid |
| (1S,4R)-(+)-2-Oxo-10-bornanesulfonic Acid |
| [(1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]hept-1-yl]methanesulfonic acid |
| ((1S,4R)-7,7-Dimethyl-2-oxobicyclo-[2.2.1]heptan-1-yl)methanesulfonic acid |
| (1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptane-1-methanesulfonic Acid |
| (1S)-(+)-CSA |
| D-CAMPHORSULPHONIC ACID |
| D(+)-10-Camphorsulfonic acid |
| (S)-10-camphorsulphonic acid |
| D-10-CAMPHORSULFONIC ACID |
| 10-Camphorsulfonic acid |
| Bicyclo[2.2.1]heptane-1-methanesulfonic acid, 7,7-dimethyl-2-oxo-, (1S,4R)- |
| ((1S,4R)-7,7-Dimethyl-2-oxobicyclo[2.2.1]heptan-1-yl)methanesulfonic acid |
| Reychler's acid |
| (7,7-Dimethyl-2-oxobicyclo[2.2.1]-heptan-1-yl)methanesulfonic acid |
| (+)-10-Camphorsulfonic Acid |
| (+)-Camphor-10-sulfonic acid (β) |
| (+)-camphorsulfonicacid |
| D-REYCHLER'S ACID |
| (1S)-(+)-10-Camphorsulfonic acid |