LD-473 structure
|
Common Name | LD-473 | ||
|---|---|---|---|---|
| CAS Number | 58721-74-7 | Molecular Weight | 324.341 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 373.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C17H19F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4±27.9 °C | |
Use of LD-473LD-473 is a laser dye. |
| Name | 1,2,3,3,8-Pentamethyl-5-(trifluoromethyl)-1,2,3,8-tetrahydro-7H-pyrrolo[3,2-g]quinolin-7-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 373.0±42.0 °C at 760 mmHg |
| Molecular Formula | C17H19F3N2O |
| Molecular Weight | 324.341 |
| Flash Point | 179.4±27.9 °C |
| Exact Mass | 324.144958 |
| LogP | 4.53 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | IOUKYANHUBKAIN-UHFFFAOYSA-N |
| SMILES | CC1N(C)c2cc3c(cc2C1(C)C)c(C(F)(F)F)cc(=O)n3C |
| 1,2,3,3,8-Pentamethyl-5-(trifluoromethyl)-1,2,3,8-tetrahydro-7H-pyrrolo[3,2-g]quinolin-7-one |
| 7H-Pyrrolo[3,2-g]quinolin-7-one, 1,2,3,8-tetrahydro-1,2,3,3,8-pentamethyl-5-(trifluoromethyl)- |
| 1,2,3,8-tetrahydro-1,2,3,3,8-pentamethyl-5-(trifluoromethyl)-7h-pyrrolo(3,2-g)quinolin-7-one |
| EINECS 261-404-2 |
| 7H-Pyrrolo(3,2-g)quinolin-7-one, 1,2,3,8-tetrahydro-1,2,3,3,8-pentamethyl-5-(trifluoromethyl)- |