Meranzin hydrate structure
|
Common Name | Meranzin hydrate | ||
|---|---|---|---|---|
| CAS Number | 5875-49-0 | Molecular Weight | 278.300 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 500.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C15H18O5 | Melting Point | 130-131°C | |
| MSDS | USA | Flash Point | 188.3±23.6 °C | |
| Symbol |
GHS09 |
Signal Word | Warning | |
Use of Meranzin hydrateMeranzin hydrate, an absorbed bioactive compound from the Traditional Chinese Medicine (TCM) Chaihu-Shugan-San (CSS), possess anti-depression and anti-atherosclerosis effects[1][2]. |
| Name | Meranzin hydrate |
|---|---|
| Synonym | More Synonyms |
| Description | Meranzin hydrate, an absorbed bioactive compound from the Traditional Chinese Medicine (TCM) Chaihu-Shugan-San (CSS), possess anti-depression and anti-atherosclerosis effects[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 500.5±50.0 °C at 760 mmHg |
| Melting Point | 130-131°C |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.300 |
| Flash Point | 188.3±23.6 °C |
| Exact Mass | 278.115417 |
| PSA | 79.90000 |
| LogP | 0.61 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | KGGUASRIGLRPAX-LBPRGKRZSA-N |
| SMILES | COc1ccc2ccc(=O)oc2c1CC(O)C(C)(C)O |
| Storage condition | ?20°C |
|
Searching the cytochrome p450 enzymes for the metabolism of meranzin hydrate: a prospective antidepressant originating from Chaihu-Shugan-San.
PLoS ONE 9(11) , e113819, (2014) Meranzin hydrate (MH), an absorbed bioactive compound from the Traditional Chinese Medicine (TCM) Chaihu-Shugan-San (CSS), was first isolated in our laboratory and was found to possess anti-depression... |
| 8-(2,3-Dihydroxy-3-methylbutyl)-7-methoxy-2H-chromen-2-one |
| 8-[(2S)-2,3-Dihydroxy-3-methylbutyl]-7-methoxy-2H-chromen-2-one |