6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione
6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione structure
|
Common Name | 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione | ||
|---|---|---|---|---|
| CAS Number | 58976-89-9 | Molecular Weight | 320.33900 | |
| Density | 1.295g/cm3 | Boiling Point | 542.8ºC at 760 mmHg | |
| Molecular Formula | C20H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
Summary: 6,11-Dimethoxy-7,10-dihydrotetracene-5,12-dione (CAS: 58976-89-9, molecular formula: C20H16O4, molecular weight: 320.34), with a boiling point of 542.8°C. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 542.8ºC at 760 mmHg |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.33900 |
| Flash Point | 241.3ºC |
| Exact Mass | 320.10500 |
| PSA | 52.60000 |
| LogP | 3.13400 |
| Index of Refraction | 1.634 |
| InChIKey | FCOZJMBQSFZZEI-UHFFFAOYSA-N |
| SMILES | COc1c2c(c(OC)c3c1C(=O)c1ccccc1C3=O)CC=CC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 5 | |
CAS#:36831-93-3
CAS#:65529-77-3
CAS#:58977-07-4
CAS#:58977-08-5
CAS#:58977-09-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-dihydro-5,12-dimethoxynaphthacene-6,11-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione have? |
| A: English synonyms of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione: 1,4-dihydro-5,12-dimethoxynaphthacene-6,11-dione. |
| Q: What is the CAS number of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: CAS number of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is 58976-89-9. |
| Q: What is the molecular formula of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: Molecular formula of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is C20H16O4. |
| Q: What is the polar surface area (PSA) of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: Polar surface area (PSA) of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is 52.60000. |
| Q: What is the LogP of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: LogP of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is 3.13400. |
| Q: What are the downstream products of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: Related downstream products(CAS) of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione: 36831-93-3;65529-77-3;58977-07-4;58977-08-5;58977-09-6. |
| Q: What is the molecular weight of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: Molecular weight of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is 320.33900. |
| Q: What is the Chinese name of 58976-89-9? |
| A: Chinese name of 58976-89-9 is 58976-89-9. |
| Q: What is the boiling point of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: Boiling point of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is 542.8ºC at 760 mmHg. |
| Q: What is the English name of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione? |
| A: The English name of 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione is 6,11-dimethoxy-7,10-dihydrotetracene-5,12-dione. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |