(12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate
(12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate structure
|
Common Name | (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate | ||
|---|---|---|---|---|
| CAS Number | 58976-90-2 | Molecular Weight | 376.35900 | |
| Density | 1.371g/cm3 | Boiling Point | 599.2ºC at 760 mmHg | |
| Molecular Formula | C22H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.3ºC | |
Summary: (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate, Chinese name: (12-乙酰氧基-6,11-二氧代-1,4-二氢tetracen-5-基) 酸酯, CAS number: 58976-90-2, molecular formula: C22H16O6, molecular weight: 376.36 g/mol. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 599.2ºC at 760 mmHg |
| Molecular Formula | C22H16O6 |
| Molecular Weight | 376.35900 |
| Flash Point | 263.3ºC |
| Exact Mass | 376.09500 |
| PSA | 86.74000 |
| LogP | 2.96740 |
| Index of Refraction | 1.63 |
| InChIKey | UQPYZNYVVKWDDB-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1c2c(c(OC(C)=O)c3c1C(=O)c1ccccc1C3=O)CC=CC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 6 | |
CAS#:65529-77-3
CAS#:58976-87-7
CAS#:58976-89-9
CAS#:58977-07-4
CAS#:58977-08-5
CAS#:58977-09-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5,12-diacetoxy-1,4-dihydronaphthacene-6,11-dione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 58976-90-2? |
| A: Chinese name of 58976-90-2 is 58976-90-2. |
| Q: What is the molecular weight of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: Molecular weight of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is 376.35900. |
| Q: What is the polar surface area (PSA) of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: Polar surface area (PSA) of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is 86.74000. |
| Q: What is the SMILES notation of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: SMILES notation of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is CC(=O)Oc1c2c(c(OC(C)=O)c3c1C(=O)c1ccccc1C3=O)CC=CC2. |
| Q: What English synonyms does (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate have? |
| A: English synonyms of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate: 5,12-diacetoxy-1,4-dihydronaphthacene-6,11-dione. |
| Q: What is the InChIKey of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: InChIKey of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is UQPYZNYVVKWDDB-UHFFFAOYSA-N. |
| Q: What is the English name of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: The English name of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate. |
| Q: What are the upstream materials of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: Related upstream materials(CAS) of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate: 77972-71-5;81-64-1;79207-97-9;79208-01-8;1709-63-3;58976-81-1;64-19-7. |
| Q: What is the CAS number of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: CAS number of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is 58976-90-2. |
| Q: What is the boiling point of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate? |
| A: Boiling point of (12-acetyloxy-6,11-dioxo-1,4-dihydrotetracen-5-yl) acetate is 599.2ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |