6a,7,10,10a-tetrahydrotetracene-5,6,11,12-tetrone structure
|
Common Name | 6a,7,10,10a-tetrahydrotetracene-5,6,11,12-tetrone | ||
|---|---|---|---|---|
| CAS Number | 58976-81-1 | Molecular Weight | 292.28500 | |
| Density | 1.42g/cm3 | Boiling Point | 474.4ºC at 760 mmHg | |
| Molecular Formula | C18H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.6ºC | |
| Name | 1,4,4a,12a-tetrahydrotetracene-5,6,11,12-tetrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 474.4ºC at 760 mmHg |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.28500 |
| Flash Point | 205.6ºC |
| Exact Mass | 292.07400 |
| PSA | 68.28000 |
| LogP | 2.09640 |
| Index of Refraction | 1.661 |
| InChIKey | FJROJMWUOIHKRB-UHFFFAOYSA-N |
| SMILES | O=C1C2=C(C(=O)c3ccccc31)C(=O)C1CC=CCC1C2=O |
|
~%
6a,7,10,10a-tet... CAS#:58976-81-1 |
| Literature: Lee; Martinez; Smith; Henry Journal of Organic Chemistry, 1976 , vol. 41, # 13 p. 2296 - 2303 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 1,4-dihydrotetracene-5,6,11,12-tetrone |