3-Nitroisonicotinic acid structure
|
Common Name | 3-Nitroisonicotinic acid | ||
|---|---|---|---|---|
| CAS Number | 59290-82-3 | Molecular Weight | 168.107 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 467.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C6H4N2O4 | Melting Point | ca 220℃ | |
| MSDS | N/A | Flash Point | 236.4±24.6 °C | |
| Name | 3-Nitroisonicotinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.3±30.0 °C at 760 mmHg |
| Melting Point | ca 220℃ |
| Molecular Formula | C6H4N2O4 |
| Molecular Weight | 168.107 |
| Flash Point | 236.4±24.6 °C |
| Exact Mass | 168.017105 |
| PSA | 96.01000 |
| LogP | 0.31 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | YKPIUHZVTZWEEW-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccncc1[N+](=O)[O-] |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-nitropyridine-4-carboxylic acid |
| 3-Nitroisonicotinic acid |
| MFCD04114244 |