Tetraethyl octane-1,8-diylbis(phosphonate) structure
|
Common Name | Tetraethyl octane-1,8-diylbis(phosphonate) | ||
|---|---|---|---|---|
| CAS Number | 5943-61-3 | Molecular Weight | 386.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H36O6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tetraethyl octane-1,8-diylbis(phosphonate)Tetraethyl octane-1,8-diylbis(phosphonate) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Octamethylen-bis-(diethylphosphonat) |
|---|---|
| Synonym | More Synonyms |
| Description | Tetraethyl octane-1,8-diylbis(phosphonate) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C16H36O6P2 |
|---|---|
| Molecular Weight | 386.40100 |
| Exact Mass | 386.19900 |
| PSA | 90.68000 |
| LogP | 5.85920 |
| InChIKey | BEWTYNZLBMSWOS-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CCCCCCCCP(=O)(OCC)OCC)OCC |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| MFCD24539459 |