1,8-Diphosphonooctane,1,8-octanediylbis-phosphonic acid,C8BPA structure
|
Common Name | 1,8-Diphosphonooctane,1,8-octanediylbis-phosphonic acid,C8BPA | ||
|---|---|---|---|---|
| CAS Number | 5943-66-8 | Molecular Weight | 274.18800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H20O6P2 | Melting Point | 180-185ºC | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 8-phosphonooctylphosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 180-185ºC |
|---|---|
| Molecular Formula | C8H20O6P2 |
| Molecular Weight | 274.18800 |
| Exact Mass | 274.07400 |
| PSA | 134.68000 |
| LogP | 1.68240 |
| InChIKey | VRAVNKVHQXXAQW-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)CCCCCCCCP(=O)(O)O |
|
~%
1,8-Diphosphono... CAS#:5943-66-8 |
| Literature: Kosolapoff,G.M.; Brown,A.D. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 757 - 759 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Octamethylen-diphosphonsaeure |
| 1,8-octanediylbis-phosphonic acid |
| C8BPA |
| 1,8-Diphosphonooctane,1,8-octanediylbis-phosphonic acid,C8BPA |
| 1,8-Diphosphonooctane |
| 1,8-Octanediphosphonic acid |
| 1,8-octylenediphosphonic acid |