soyasapogenol B structure
|
Common Name | soyasapogenol B | ||
|---|---|---|---|---|
| CAS Number | 595-15-3 | Molecular Weight | 458.716 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 555.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H50O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 226.6±24.7 °C | |
Use of soyasapogenol BSoyasapogenol B, an ingredient of soybean, exerts anti-proliferative, anti-metastatic activities. Soyasapogenol B triggers endoplasmic reticulum stress, which mediates apoptosis and autophagy in colorectal cancer[1][2]. |
| Name | soyasapogenol B |
|---|---|
| Synonym | More Synonyms |
| Description | Soyasapogenol B, an ingredient of soybean, exerts anti-proliferative, anti-metastatic activities. Soyasapogenol B triggers endoplasmic reticulum stress, which mediates apoptosis and autophagy in colorectal cancer[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 555.5±50.0 °C at 760 mmHg |
| Molecular Formula | C30H50O3 |
| Molecular Weight | 458.716 |
| Flash Point | 226.6±24.7 °C |
| Exact Mass | 458.376007 |
| PSA | 60.69000 |
| LogP | 7.41 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | YOQAQNKGFOLRGT-UXXABWCISA-N |
| SMILES | CC1(C)CC(O)C2(C)CCC3(C)C(=CCC4C5(C)CCC(O)C(C)(CO)C5CCC43C)C2C1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| soyasapogenin B |
| 21-HYDROXYPREGNENOLONE 3,21-DIACETATE |
| Soyasapogenol B |
| (3β,22β)-Olean-12-ene-3,22,24-triol |