4-chloro-N-propan-2-ylpyridine-3-sulfonamide
4-chloro-N-propan-2-ylpyridine-3-sulfonamide structure
|
Common Name | 4-chloro-N-propan-2-ylpyridine-3-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 59582-92-2 | Molecular Weight | 234.70300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H11ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-N-propan-2-ylpyridine-3-sulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H11ClN2O2S |
|---|---|
| Molecular Weight | 234.70300 |
| Exact Mass | 234.02300 |
| PSA | 67.44000 |
| LogP | 2.89340 |
| InChIKey | NGFUAIQLURUVMT-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)c1cnccc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~55%
4-chloro-N-prop... CAS#:59582-92-2 |
| Literature: Pirotte, Bernard; Podona, Tchao; Diouf, Ousmane; De Tullio, Pascal; Lebrun, Philippe; Dupont, Leon; Somers, Fabian; Delarge, Jacques; Morain, Philippe; Lestage, Pierre; Lepagnol, Jean; Spedding, Michael Journal of Medicinal Chemistry, 1998 , vol. 41, # 16 p. 2946 - 2959 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-Pyridinesulfonamide,4-chloro-N-(1-methylethyl) |
| 4-chloro-pyridine-3-sulfonic acid isopropylamide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: CAS number of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is 59582-92-2. |
| Q: What is the molecular weight of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: Molecular weight of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is 234.70300. |
| Q: What is the polar surface area (PSA) of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: Polar surface area (PSA) of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is 67.44000. |
| Q: What English synonyms does 4-chloro-N-propan-2-ylpyridine-3-sulfonamide have? |
| A: English synonyms of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide: 3-Pyridinesulfonamide,4-chloro-N-(1-methylethyl), 4-chloro-pyridine-3-sulfonic acid isopropylamide. |
| Q: What is the SMILES notation of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: SMILES notation of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is CC(C)NS(=O)(=O)c1cnccc1Cl. |
| Q: What is the LogP of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: LogP of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is 2.89340. |
| Q: What is the molecular formula of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: Molecular formula of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is C8H11ClN2O2S. |
| Q: What is the Chinese name of 59582-92-2? |
| A: Chinese name of 59582-92-2 is 59582-92-2. |
| Q: What is the English name of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: The English name of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is 4-chloro-N-propan-2-ylpyridine-3-sulfonamide. |
| Q: What is the InChIKey of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide? |
| A: InChIKey of 4-chloro-N-propan-2-ylpyridine-3-sulfonamide is NGFUAIQLURUVMT-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |