2-(4-methoxy-benzenesulfonylamino)-propionic acid structure
|
Common Name | 2-(4-methoxy-benzenesulfonylamino)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 59724-73-1 | Molecular Weight | 259.27900 | |
| Density | 1.35g/cm3 | Boiling Point | 454.2ºC at 760 mmHg | |
| Molecular Formula | C10H13NO5S | Melting Point | 138-141ºC | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 2-(4-methoxy-benzenesulfonylamino)-propionic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 454.2ºC at 760 mmHg |
| Melting Point | 138-141ºC |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.27900 |
| Flash Point | 228.5ºC |
| Exact Mass | 259.05100 |
| PSA | 101.08000 |
| LogP | 1.91830 |
| Index of Refraction | 1.549 |
| InChIKey | XTCIPBHRVYICGT-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)NC(C)C(=O)O)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2935009090 |
|
~%
2-(4-methoxy-be... CAS#:59724-73-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 40, # 16 p. 2525 - 2532 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| iflab-bb f1475-0279 |