4'-Butoxy-4-biphenylcarboxylic acid structure
|
Common Name | 4'-Butoxy-4-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 59748-14-0 | Molecular Weight | 270.323 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 438.0±38.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | 267-268ºC | |
| MSDS | N/A | Flash Point | 159.7±20.3 °C | |
| Name | 4-(4-butoxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.0±38.0 °C at 760 mmHg |
| Melting Point | 267-268ºC |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.323 |
| Flash Point | 159.7±20.3 °C |
| Exact Mass | 270.125580 |
| PSA | 46.53000 |
| LogP | 5.16 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | CMNSCPHEWQDYHW-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| HS Code | 2922299090 |
|---|
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-N-Butyloxybiphenyl-4-N'-carboxylicacid |
| 4-<4'-(butyloxy)phenyl>benzoic acid |
| 4-N-Butyloxybiphenyl-4'-carboxylic acid |
| 4'-butoxy-biphenyl-4-carboxylic acid |
| 4'-Butoxybiphenyl-4-carboxylic acid |
| 4'-Butoxy-biphenyl-4-carbonsaeure |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-butoxy- |
| 4-BUTOXY-4'-BIPHENYLCARBOXYLIC ACID |
| 4'-Butoxy-4-biphenylcarboxylic acid |
| 1-(butyloxy)-4'-carboxybiphenyl |
| 4-(4-n-butyloxyphenyl)-benzoic acid |
| 4-(4-n-Butyloxyphenyl)benzoesaeure |