4'-Hydroxy-4-biphenylcarboxylic acid structure
|
Common Name | 4'-Hydroxy-4-biphenylcarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 58574-03-1 | Molecular Weight | 214.217 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 420.4±28.0 °C at 760 mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | 295 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 222.2±20.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4'-Hydroxy-4-biphenylcarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 420.4±28.0 °C at 760 mmHg |
| Melting Point | 295 °C (dec.)(lit.) |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.217 |
| Flash Point | 222.2±20.5 °C |
| Exact Mass | 214.062988 |
| PSA | 57.53000 |
| LogP | 2.97 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | JTGCXYYDAVPSFD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(-c2ccc(O)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922299090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-Hydroxy-4-biphenylcarboxylic acid |
| [1,1'-Biphenyl]-4-carboxylic acid, 4'-hydroxy- |
| 4-(4-hydroxyphenyl)benzoic acid |
| 4'-hydroxybiphenyl-4-carboxylic acid |
| MFCD00059078 |
| 4-(4-Hydroxyphenyl)benzoicAcid |