4'-Hydroxy-4-biphenylcarbonitrile structure
|
Common Name | 4'-Hydroxy-4-biphenylcarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 19812-93-2 | Molecular Weight | 195.217 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 379.8±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H9NO | Melting Point | 192-199 °C | |
| MSDS | Chinese USA | Flash Point | 183.5±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-hydroxyphenyl)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 379.8±25.0 °C at 760 mmHg |
| Melting Point | 192-199 °C |
| Molecular Formula | C13H9NO |
| Molecular Weight | 195.217 |
| Flash Point | 183.5±23.2 °C |
| Exact Mass | 195.068420 |
| PSA | 44.02000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | ZRMIETZFPZGBEB-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(-c2ccc(O)cc2)cc1 |
| Storage condition | Room temperature. |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S36/37/39-S26-S22-S36/37-S9-S36 |
| RIDADR | 3439 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 2926909090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Structure-Property Correlations in Cyanobiphenyl-Based Dimer-Like Mesogens.
J. Phys. Chem. B 119 , 11935-52, (2015) In this contribution, we present the results of our extensive investigations on the synthesis and phase behavior of five series of dimer-like compounds formed by covalently linking a promesogenic, cya... |
| 4'-Hydroxybiphenyl-4-carbonitrile |
| 4'-cyanobiphenyl-4-ol |
| 4‘-Hydroxy-4-biphenylcarbonitrile |
| 4′-hydroxy-4-biphenylcarbonitrile |
| 4'-Cyano-4-biphenylol |
| 4'-Hydroxy[1,1'-biphenyl]-4-carbonitrile |
| 4-Cyano-4'-hydroxybiphenyl |
| 4'-Hydroxy-4-biphenylcarbonitrile |
| [1,1'-Biphenyl]-4-carbonitrile, 4'-hydroxy- |
| 4-Hydroxybiphenyl-4-Carbonitrile |
| MFCD00059625 |
| 4-(4-Hydroxyphenyl)benzonitrile |
| 4'-hydroxy-4-cyanobiphenyl |
| EINECS 427-840-4 |