4'-n-Octyloxybiphenyl-4-carboxylic acid structure
|
Common Name | 4'-n-Octyloxybiphenyl-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 59748-18-4 | Molecular Weight | 326.42900 | |
| Density | 1.063g/cm3 | Boiling Point | 483.3ºC at 760 mmHg | |
| Molecular Formula | C21H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.8ºC | |
| Name | 4-(4-octoxyphenyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.063g/cm3 |
|---|---|
| Boiling Point | 483.3ºC at 760 mmHg |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.42900 |
| Flash Point | 165.8ºC |
| Exact Mass | 326.18800 |
| PSA | 46.53000 |
| LogP | 5.79110 |
| Index of Refraction | 1.544 |
| InChIKey | YNBBQLUKHHSKPW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(4-octyloxyphenyl)benzoic acid |
| 4-(4'-n-octyloxyphenyl)-benzoic acid |
| 4'-octyloxy(1,1'-biphenyl)-4-carboxylic acid |
| 4-n-octyloxybiphenyl-4'-carboxylic acid |
| 4'-(octyloxy)biphenyl-4-carboxylic acid |
| 4'-octyloxy-4-biphenylcarboxylic acid |
| MFCD00192369 |